About 4-N-butyl-5,6-dimethylpyrimidine-2,4-diamine
4-N-butyl-5,6-dimethylpyrimidine-2,4-diamine (PubChem CID 135271001) has the molecular formula C10H18N4
and a molecular weight of 194.28 g/mol. Its IUPAC name is 4-N-butyl-5,6-dimethylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 4-N-butyl-5,6-dimethylpyrimidine-2,4-diamine |
| PubChem CID | 135271001 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 4-N-butyl-5,6-dimethylpyrimidine-2,4-diamine |
| SMILES | CCCCNc1nc(N)nc(C)c1C |
| InChI | InChI=1S/C10H18N4/c1-4-5-6-12-9-7(2)8(3)13-10(11)14-9/h4-6H2,1-3H3,(H3,11,12,13,14) |
| InChIKey | NDPHLXRLJFNHMY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-N-butyl-5,6-dimethylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-butyl-5,6-dimethylpyrimidine-2,4-diamine?
The IUPAC name of 4-N-butyl-5,6-dimethylpyrimidine-2,4-diamine (CID 135271001) is 4-N-butyl-5,6-dimethylpyrimidine-2,4-diamine.
What is the SMILES notation for 4-N-butyl-5,6-dimethylpyrimidine-2,4-diamine?
The canonical SMILES for 4-N-butyl-5,6-dimethylpyrimidine-2,4-diamine is CCCCNc1nc(N)nc(C)c1C.
What is the InChIKey of 4-N-butyl-5,6-dimethylpyrimidine-2,4-diamine?
The InChIKey is NDPHLXRLJFNHMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4/c1-4-5-6-12-9-7(2)8(3)13-10(11)14-9/h4-6H2,1-3H3,(H3,11,12,13,14).
What are the key properties of 4-N-butyl-5,6-dimethylpyrimidine-2,4-diamine?
4-N-butyl-5,6-dimethylpyrimidine-2,4-diamine has a molecular weight of 194.28 g/mol, XLogP of 1.89, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-butyl-5,6-dimethylpyrimidine-2,4-diamine is sourced from PubChem (CID 135271001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).