C8H14N4 — CID 137384091
4-N-ethyl-5,6-dimethylpyrimidine-2,4-diamine (PubChem CID 137384091) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is 4-N-ethyl-5,6-dimethylpyrimidine-2,4-diamine.
| Compound Name | 4-N-ethyl-5,6-dimethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 137384091 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 4-N-ethyl-5,6-dimethylpyrimidine-2,4-diamine |
| SMILES | CCNc1nc(N)nc(C)c1C |
| InChI | InChI=1S/C8H14N4/c1-4-10-7-5(2)6(3)11-8(9)12-7/h4H2,1-3H3,(H3,9,10,11,12) |
| InChIKey | KKIXLOZILLJRME-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |