C11H17N7S — CID 72918603
5,6-dimethyl-4-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]pyrimidine-2,4-diamine (PubChem CID 72918603) has the molecular formula C11H17N7S and a molecular weight of 279.37 g/mol. Its IUPAC name is 5,6-dimethyl-4-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]pyrimidine-2,4-diamine.
| Compound Name | 5,6-dimethyl-4-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 72918603 |
| Molecular Formula | C11H17N7S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 5,6-dimethyl-4-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]pyrimidine-2,4-diamine |
| SMILES | Cc1nc(SCCNc2nc(N)nc(C)c2C)n[nH]1 |
| InChI | InChI=1S/C11H17N7S/c1-6-7(2)14-10(12)16-9(6)13-4-5-19-11-15-8(3)17-18-11/h4-5H2,1-3H3,(H,15,17,18)(H3,12,13,14,16) |
| InChIKey | XYTKGTSLNRAXII-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|