C14H22N4 — CID 135271020
4-N-butyl-6-methyl-5-pent-1-ynylpyrimidine-2,4-diamine (PubChem CID 135271020) has the molecular formula C14H22N4 and a molecular weight of 246.36 g/mol. Its IUPAC name is 4-N-butyl-6-methyl-5-pent-1-ynylpyrimidine-2,4-diamine.
| Compound Name | 4-N-butyl-6-methyl-5-pent-1-ynylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 135271020 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 4-N-butyl-6-methyl-5-pent-1-ynylpyrimidine-2,4-diamine |
| SMILES | CCCC#Cc1c(C)nc(N)nc1NCCCC |
| InChI | InChI=1S/C14H22N4/c1-4-6-8-9-12-11(3)17-14(15)18-13(12)16-10-7-5-2/h4-7,10H2,1-3H3,(H3,15,16,17,18) |
| InChIKey | CJSLGPXZDUIWKZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|