C11H16N4 — CID 134914335
3-(butylamino)-5,6-dimethylpyrazine-2-carbonitrile (PubChem CID 134914335) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is 3-(butylamino)-5,6-dimethylpyrazine-2-carbonitrile.
| Compound Name | 3-(butylamino)-5,6-dimethylpyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 134914335 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 3-(butylamino)-5,6-dimethylpyrazine-2-carbonitrile |
| SMILES | CCCCNc1nc(C)c(C)nc1C#N |
| InChI | InChI=1S/C11H16N4/c1-4-5-6-13-11-10(7-12)14-8(2)9(3)15-11/h4-6H2,1-3H3,(H,13,15) |
| InChIKey | CMTKJYXHFHOYBR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|