C8H12N4O — CID 102795776
5-amino-3-(butylamino)-1,2-oxazole-4-carbonitrile (PubChem CID 102795776) has the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. Its IUPAC name is 5-amino-3-(butylamino)-1,2-oxazole-4-carbonitrile.
| Compound Name | 5-amino-3-(butylamino)-1,2-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 102795776 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 5-amino-3-(butylamino)-1,2-oxazole-4-carbonitrile |
| SMILES | CCCCNc1noc(N)c1C#N |
| InChI | InChI=1S/C8H12N4O/c1-2-3-4-11-8-6(5-9)7(10)13-12-8/h2-4,10H2,1H3,(H,11,12) |
| InChIKey | ZRLLAMNLIYOTQE-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 87.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|