C14H15N3S — CID 86278738
3-(butylamino)-5-phenyl-1,2-thiazole-4-carbonitrile (PubChem CID 86278738) has the molecular formula C14H15N3S and a molecular weight of 257.36 g/mol. Its IUPAC name is 3-(butylamino)-5-phenyl-1,2-thiazole-4-carbonitrile.
| Compound Name | 3-(butylamino)-5-phenyl-1,2-thiazole-4-carbonitrile |
|---|---|
| PubChem CID | 86278738 |
| Molecular Formula | C14H15N3S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 3-(butylamino)-5-phenyl-1,2-thiazole-4-carbonitrile |
| SMILES | CCCCNc1nsc(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C14H15N3S/c1-2-3-9-16-14-12(10-15)13(18-17-14)11-7-5-4-6-8-11/h4-8H,2-3,9H2,1H3,(H,16,17) |
| InChIKey | LFTWZXSFNUFESR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|