C17H18N4 — CID 3112193
1-(butylamino)-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile (PubChem CID 3112193) has the molecular formula C17H18N4 and a molecular weight of 278.36 g/mol. Its IUPAC name is 1-(butylamino)-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile.
| Compound Name | 1-(butylamino)-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 3112193 |
| Molecular Formula | C17H18N4 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 1-(butylamino)-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile |
| SMILES | CCCCNc1cc(C)c(C#N)c2nc3ccccc3n12 |
| InChI | InChI=1S/C17H18N4/c1-3-4-9-19-16-10-12(2)13(11-18)17-20-14-7-5-6-8-15(14)21(16)17/h5-8,10,19H,3-4,9H2,1-2H3 |
| InChIKey | PDBMMPSXBQYWCE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 53.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|