C19H22N4O — CID 45043498
16-(butylamino)-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile;hydrate (PubChem CID 45043498) has the molecular formula C19H22N4O and a molecular weight of 322.41 g/mol. Its IUPAC name is 16-(butylamino)-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile;hydrate.
| Compound Name | 16-(butylamino)-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile;hydrate |
|---|---|
| PubChem CID | 45043498 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 16-(butylamino)-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile;hydrate |
| SMILES | CCCCNc1c2c(c(C#N)c3nc4ccccc4n13)CCC2.O |
| InChI | InChI=1S/C19H20N4.H2O/c1-2-3-11-21-18-14-8-6-7-13(14)15(12-20)19-22-16-9-4-5-10-17(16)23(18)19;/h4-5,9-10,21H,2-3,6-8,11H2,1H3;1H2 |
| InChIKey | HCTFPOMVRRNPMJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 84.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|