C23H32N5+ — CID 7103559
3-[(4-cyano-3-methyl-2-pentylpyrido[1,2-a]benzimidazol-1-yl)amino]propyl-dimethylazanium (PubChem CID 7103559) has the molecular formula C23H32N5+ and a molecular weight of 378.54 g/mol. Its IUPAC name is 3-[(4-cyano-3-methyl-2-pentylpyrido[1,2-a]benzimidazol-1-yl)amino]propyl-dimethylazanium.
| Compound Name | 3-[(4-cyano-3-methyl-2-pentylpyrido[1,2-a]benzimidazol-1-yl)amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7103559 |
| Molecular Formula | C23H32N5+ |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | 3-[(4-cyano-3-methyl-2-pentylpyrido[1,2-a]benzimidazol-1-yl)amino]propyl-dimethylazanium |
| SMILES | CCCCCc1c(C)c(C#N)c2nc3ccccc3n2c1NCCC[NH+](C)C |
| InChI | InChI=1S/C23H31N5/c1-5-6-7-11-18-17(2)19(16-24)23-26-20-12-8-9-13-21(20)28(23)22(18)25-14-10-15-27(3)4/h8-9,12-13,25H,5-7,10-11,14-15H2,1-4H3/p+1 |
| InChIKey | OVUAXTMUSYRBSI-UHFFFAOYSA-O |
| XLogP | 3.35 |
| TPSA | 57.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|