C31H47N5 — CID 135507308
N'-octyl-16-(octylamino)-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carboximidamide (PubChem CID 135507308) has the molecular formula C31H47N5 and a molecular weight of 489.75 g/mol. Its IUPAC name is N'-octyl-16-(octylamino)-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carboximidamide.
| Compound Name | N'-octyl-16-(octylamino)-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carboximidamide |
|---|---|
| PubChem CID | 135507308 |
| Molecular Formula | C31H47N5 |
| Molecular Weight | 489.75 g/mol |
| Exact Mass | 489.38 |
| IUPAC Name | N'-octyl-16-(octylamino)-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carboximidamide |
| SMILES | CCCCCCCC/N=C(\N)c1c2c(c(NCCCCCCCC)n3c1nc1ccccc13)CCC2 |
| InChI | InChI=1S/C31H47N5/c1-3-5-7-9-11-15-22-33-29(32)28-24-18-17-19-25(24)30(34-23-16-12-10-8-6-4-2)36-27-21-14-13-20-26(27)35-31(28)36/h13-14,20-21,34H,3-12,15-19,22-23H2,1-2H3,(H2,32,33) |
| InChIKey | GMVKEMAIBHBZNR-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.75 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|