C22H27N5 — CID 3157183
16-[3-(diethylamino)propylamino]-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile (PubChem CID 3157183) has the molecular formula C22H27N5 and a molecular weight of 361.49 g/mol. Its IUPAC name is 16-[3-(diethylamino)propylamino]-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile.
| Compound Name | 16-[3-(diethylamino)propylamino]-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile |
|---|---|
| PubChem CID | 3157183 |
| Molecular Formula | C22H27N5 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | 16-[3-(diethylamino)propylamino]-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile |
| SMILES | CCN(CC)CCCNc1c2c(c(C#N)c3nc4ccccc4n13)CCC2 |
| InChI | InChI=1S/C22H27N5/c1-3-26(4-2)14-8-13-24-21-17-10-7-9-16(17)18(15-23)22-25-19-11-5-6-12-20(19)27(21)22/h5-6,11-12,24H,3-4,7-10,13-14H2,1-2H3 |
| InChIKey | VQQIYRDBVXWEHH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 56.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|