C17H18N4OS — CID 95309621
3-methyl-1-[3-[(R)-methylsulfinyl]propylamino]pyrido[1,2-a]benzimidazole-4-carbonitrile (PubChem CID 95309621) has the molecular formula C17H18N4OS and a molecular weight of 326.43 g/mol. Its IUPAC name is 3-methyl-1-[3-[(R)-methylsulfinyl]propylamino]pyrido[1,2-a]benzimidazole-4-carbonitrile.
| Compound Name | 3-methyl-1-[3-[(R)-methylsulfinyl]propylamino]pyrido[1,2-a]benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 95309621 |
| Molecular Formula | C17H18N4OS |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 3-methyl-1-[3-[(R)-methylsulfinyl]propylamino]pyrido[1,2-a]benzimidazole-4-carbonitrile |
| SMILES | Cc1cc(NCCC[S@@](C)=O)n2c(nc3ccccc32)c1C#N |
| InChI | InChI=1S/C17H18N4OS/c1-12-10-16(19-8-5-9-23(2)22)21-15-7-4-3-6-14(15)20-17(21)13(12)11-18/h3-4,6-7,10,19H,5,8-9H2,1-2H3/t23-/m1/s1 |
| InChIKey | WKYPLVSRJJHGRF-HSZRJFAPSA-N |
| XLogP | 2.85 |
| TPSA | 70.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|