C20H22N4O2 — CID 133315015
3-methyl-1-[2-(oxolan-2-ylmethoxy)ethylamino]pyrido[1,2-a]benzimidazole-4-carbonitrile (PubChem CID 133315015) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 3-methyl-1-[2-(oxolan-2-ylmethoxy)ethylamino]pyrido[1,2-a]benzimidazole-4-carbonitrile.
| Compound Name | 3-methyl-1-[2-(oxolan-2-ylmethoxy)ethylamino]pyrido[1,2-a]benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 133315015 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 3-methyl-1-[2-(oxolan-2-ylmethoxy)ethylamino]pyrido[1,2-a]benzimidazole-4-carbonitrile |
| SMILES | Cc1cc(NCCOCC2CCCO2)n2c(nc3ccccc32)c1C#N |
| InChI | InChI=1S/C20H22N4O2/c1-14-11-19(22-8-10-25-13-15-5-4-9-26-15)24-18-7-3-2-6-17(18)23-20(24)16(14)12-21/h2-3,6-7,11,15,22H,4-5,8-10,13H2,1H3 |
| InChIKey | PCFHYRLNMWZGLC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|