C19H14N4O — CID 950637
1-(2-hydroxyanilino)-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile (PubChem CID 950637) has the molecular formula C19H14N4O and a molecular weight of 314.35 g/mol. Its IUPAC name is 1-(2-hydroxyanilino)-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile.
| Compound Name | 1-(2-hydroxyanilino)-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 950637 |
| Molecular Formula | C19H14N4O |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 1-(2-hydroxyanilino)-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile |
| SMILES | Cc1cc(Nc2ccccc2O)n2c(nc3ccccc32)c1C#N |
| InChI | InChI=1S/C19H14N4O/c1-12-10-18(21-15-7-3-5-9-17(15)24)23-16-8-4-2-6-14(16)22-19(23)13(12)11-20/h2-10,21,24H,1H3 |
| InChIKey | NIMDPMSSGYOJOU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 73.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|