C13H8IN3 — CID 88919839
1-iodo-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile (PubChem CID 88919839) has the molecular formula C13H8IN3 and a molecular weight of 333.13 g/mol. Its IUPAC name is 1-iodo-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile.
| Compound Name | 1-iodo-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 88919839 |
| Molecular Formula | C13H8IN3 |
| Molecular Weight | 333.13 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | 1-iodo-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile |
| SMILES | Cc1cc(I)n2c(nc3ccccc32)c1C#N |
| InChI | InChI=1S/C13H8IN3/c1-8-6-12(14)17-11-5-3-2-4-10(11)16-13(17)9(8)7-15/h2-6H,1H3 |
| InChIKey | CCWFDJPJDQYDPA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 41.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.13 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|