C15H12ClN3 — CID 142668218
1-(1-chloroethyl)-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile (PubChem CID 142668218) has the molecular formula C15H12ClN3 and a molecular weight of 269.74 g/mol. Its IUPAC name is 1-(1-chloroethyl)-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile.
| Compound Name | 1-(1-chloroethyl)-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 142668218 |
| Molecular Formula | C15H12ClN3 |
| Molecular Weight | 269.74 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 1-(1-chloroethyl)-3-methylpyrido[1,2-a]benzimidazole-4-carbonitrile |
| SMILES | Cc1cc(C(C)Cl)n2c(nc3ccccc32)c1C#N |
| InChI | InChI=1S/C15H12ClN3/c1-9-7-14(10(2)16)19-13-6-4-3-5-12(13)18-15(19)11(9)8-17/h3-7,10H,1-2H3 |
| InChIKey | AWUNGPYCRUYLNI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 41.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.74 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|