C22H16N4O2 — CID 6088996
(E)-3-[3-[(4-cyano-3-methylpyrido[1,2-a]benzimidazol-1-yl)amino]phenyl]prop-2-enoic acid (PubChem CID 6088996) has the molecular formula C22H16N4O2 and a molecular weight of 368.40 g/mol. Its IUPAC name is (E)-3-[3-[(4-cyano-3-methylpyrido[1,2-a]benzimidazol-1-yl)amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[(4-cyano-3-methylpyrido[1,2-a]benzimidazol-1-yl)amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 6088996 |
| Molecular Formula | C22H16N4O2 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (E)-3-[3-[(4-cyano-3-methylpyrido[1,2-a]benzimidazol-1-yl)amino]phenyl]prop-2-enoic acid |
| SMILES | Cc1cc(Nc2cccc(/C=C/C(=O)O)c2)n2c(nc3ccccc32)c1C#N |
| InChI | InChI=1S/C22H16N4O2/c1-14-11-20(24-16-6-4-5-15(12-16)9-10-21(27)28)26-19-8-3-2-7-18(19)25-22(26)17(14)13-23/h2-12,24H,1H3,(H,27,28)/b10-9+ |
| InChIKey | QUNVQHLIAVDNIV-MDZDMXLPSA-N |
| XLogP | 4.51 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|