C17H17N5 — CID 13359707
2-amino-6-(butylamino)-4-phenylpyridine-3,5-dicarbonitrile (PubChem CID 13359707) has the molecular formula C17H17N5 and a molecular weight of 291.36 g/mol. Its IUPAC name is 2-amino-6-(butylamino)-4-phenylpyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-6-(butylamino)-4-phenylpyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 13359707 |
| Molecular Formula | C17H17N5 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-amino-6-(butylamino)-4-phenylpyridine-3,5-dicarbonitrile |
| SMILES | CCCCNc1nc(N)c(C#N)c(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C17H17N5/c1-2-3-9-21-17-14(11-19)15(12-7-5-4-6-8-12)13(10-18)16(20)22-17/h4-8H,2-3,9H2,1H3,(H3,20,21,22) |
| InChIKey | ZLNNTRKLXKKQDP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 98.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|