C21H16N4 — CID 3402109
2-amino-4-(4-cyanophenyl)-5-ethyl-6-phenylpyridine-3-carbonitrile (PubChem CID 3402109) has the molecular formula C21H16N4 and a molecular weight of 324.39 g/mol. Its IUPAC name is 2-amino-4-(4-cyanophenyl)-5-ethyl-6-phenylpyridine-3-carbonitrile.
| Compound Name | 2-amino-4-(4-cyanophenyl)-5-ethyl-6-phenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3402109 |
| Molecular Formula | C21H16N4 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2-amino-4-(4-cyanophenyl)-5-ethyl-6-phenylpyridine-3-carbonitrile |
| SMILES | CCc1c(-c2ccccc2)nc(N)c(C#N)c1-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C21H16N4/c1-2-17-19(15-10-8-14(12-22)9-11-15)18(13-23)21(24)25-20(17)16-6-4-3-5-7-16/h3-11H,2H2,1H3,(H2,24,25) |
| InChIKey | WZBHDPIBFPYBGX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 86.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |