C18H14BrN3S — CID 5208158
2-amino-4-(4-bromothiophen-2-yl)-5-ethyl-6-phenylpyridine-3-carbonitrile (PubChem CID 5208158) has the molecular formula C18H14BrN3S and a molecular weight of 384.30 g/mol. Its IUPAC name is 2-amino-4-(4-bromothiophen-2-yl)-5-ethyl-6-phenylpyridine-3-carbonitrile.
| Compound Name | 2-amino-4-(4-bromothiophen-2-yl)-5-ethyl-6-phenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 5208158 |
| Molecular Formula | C18H14BrN3S |
| Molecular Weight | 384.30 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | 2-amino-4-(4-bromothiophen-2-yl)-5-ethyl-6-phenylpyridine-3-carbonitrile |
| SMILES | CCc1c(-c2ccccc2)nc(N)c(C#N)c1-c1cc(Br)cs1 |
| InChI | InChI=1S/C18H14BrN3S/c1-2-13-16(15-8-12(19)10-23-15)14(9-20)18(21)22-17(13)11-6-4-3-5-7-11/h3-8,10H,2H2,1H3,(H2,21,22) |
| InChIKey | XCPGQWXOZWDALQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.30 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |