C17H12BrN3S — CID 5230853
2-amino-4-(4-bromothiophen-2-yl)-6-(2-methylphenyl)pyridine-3-carbonitrile (PubChem CID 5230853) has the molecular formula C17H12BrN3S and a molecular weight of 370.28 g/mol. Its IUPAC name is 2-amino-4-(4-bromothiophen-2-yl)-6-(2-methylphenyl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-4-(4-bromothiophen-2-yl)-6-(2-methylphenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 5230853 |
| Molecular Formula | C17H12BrN3S |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 368.99 |
| IUPAC Name | 2-amino-4-(4-bromothiophen-2-yl)-6-(2-methylphenyl)pyridine-3-carbonitrile |
| SMILES | Cc1ccccc1-c1cc(-c2cc(Br)cs2)c(C#N)c(N)n1 |
| InChI | InChI=1S/C17H12BrN3S/c1-10-4-2-3-5-12(10)15-7-13(14(8-19)17(20)21-15)16-6-11(18)9-22-16/h2-7,9H,1H3,(H2,20,21) |
| InChIKey | IMBYJJQHTUCPJX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |