C16H11N3OS — CID 136909232
2-amino-6-(2-hydroxyphenyl)-4-thiophen-2-ylpyridine-3-carbonitrile (PubChem CID 136909232) has the molecular formula C16H11N3OS and a molecular weight of 293.35 g/mol. Its IUPAC name is 2-amino-6-(2-hydroxyphenyl)-4-thiophen-2-ylpyridine-3-carbonitrile.
| Compound Name | 2-amino-6-(2-hydroxyphenyl)-4-thiophen-2-ylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 136909232 |
| Molecular Formula | C16H11N3OS |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 2-amino-6-(2-hydroxyphenyl)-4-thiophen-2-ylpyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2cccs2)cc(-c2ccccc2O)nc1N |
| InChI | InChI=1S/C16H11N3OS/c17-9-12-11(15-6-3-7-21-15)8-13(19-16(12)18)10-4-1-2-5-14(10)20/h1-8,20H,(H2,18,19) |
| InChIKey | VAJDZNLGRUZYKZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 82.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |