C22H15N3OS2 — CID 1010503
2-[(3-cyano-6-naphthalen-2-yl-4-thiophen-2-yl-2-pyridinyl)sulfanyl]acetamide (PubChem CID 1010503) has the molecular formula C22H15N3OS2 and a molecular weight of 401.52 g/mol. Its IUPAC name is 2-[(3-cyano-6-naphthalen-2-yl-4-thiophen-2-yl-2-pyridinyl)sulfanyl]acetamide.
| Compound Name | 2-[(3-cyano-6-naphthalen-2-yl-4-thiophen-2-yl-2-pyridinyl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 1010503 |
| Molecular Formula | C22H15N3OS2 |
| Molecular Weight | 401.52 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 2-[(3-cyano-6-naphthalen-2-yl-4-thiophen-2-yl-2-pyridinyl)sulfanyl]acetamide |
| SMILES | N#Cc1c(-c2cccs2)cc(-c2ccc3ccccc3c2)nc1SCC(N)=O |
| InChI | InChI=1S/C22H15N3OS2/c23-12-18-17(20-6-3-9-27-20)11-19(25-22(18)28-13-21(24)26)16-8-7-14-4-1-2-5-15(14)10-16/h1-11H,13H2,(H2,24,26) |
| InChIKey | SDMRFZOHDRLFSA-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 79.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |