C17H12N4OS2 — CID 168859889
2-(2-oxopropylsulfanyl)-6-pyrazin-2-yl-4-thiophen-2-ylpyridine-3-carbonitrile (PubChem CID 168859889) has the molecular formula C17H12N4OS2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 2-(2-oxopropylsulfanyl)-6-pyrazin-2-yl-4-thiophen-2-ylpyridine-3-carbonitrile.
| Compound Name | 2-(2-oxopropylsulfanyl)-6-pyrazin-2-yl-4-thiophen-2-ylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 168859889 |
| Molecular Formula | C17H12N4OS2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 2-(2-oxopropylsulfanyl)-6-pyrazin-2-yl-4-thiophen-2-ylpyridine-3-carbonitrile |
| SMILES | CC(=O)CSc1nc(-c2cnccn2)cc(-c2cccs2)c1C#N |
| InChI | InChI=1S/C17H12N4OS2/c1-11(22)10-24-17-13(8-18)12(16-3-2-6-23-16)7-14(21-17)15-9-19-4-5-20-15/h2-7,9H,10H2,1H3 |
| InChIKey | WFKGSMKZUOKOED-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 79.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |