C25H20N6O2S2 — CID 170459399
2-[(3-cyano-6-pyrazin-2-yl-4-thiophen-2-yl-2-pyridinyl)sulfanyl]-N-[(E)-1-(4-methoxyphenyl)ethylideneamino]acetamide (PubChem CID 170459399) has the molecular formula C25H20N6O2S2 and a molecular weight of 500.61 g/mol. Its IUPAC name is 2-[(3-cyano-6-pyrazin-2-yl-4-thiophen-2-yl-2-pyridinyl)sulfanyl]-N-[(E)-1-(4-methoxyphenyl)ethylideneamino]acetamide.
| Compound Name | 2-[(3-cyano-6-pyrazin-2-yl-4-thiophen-2-yl-2-pyridinyl)sulfanyl]-N-[(E)-1-(4-methoxyphenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 170459399 |
| Molecular Formula | C25H20N6O2S2 |
| Molecular Weight | 500.61 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | 2-[(3-cyano-6-pyrazin-2-yl-4-thiophen-2-yl-2-pyridinyl)sulfanyl]-N-[(E)-1-(4-methoxyphenyl)ethylideneamino]acetamide |
| SMILES | COc1ccc(/C(C)=N/NC(=O)CSc2nc(-c3cnccn3)cc(-c3cccs3)c2C#N)cc1 |
| InChI | InChI=1S/C25H20N6O2S2/c1-16(17-5-7-18(33-2)8-6-17)30-31-24(32)15-35-25-20(13-26)19(23-4-3-11-34-23)12-21(29-25)22-14-27-9-10-28-22/h3-12,14H,15H2,1-2H3,(H,31,32)/b30-16+ |
| InChIKey | MSQZPTBUAYMWJD-OKCVXOCRSA-N |
| XLogP | 4.78 |
| TPSA | 113.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.61 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|