C25H18N2O3S2 — CID 2962037
2-[[3-cyano-4-(4-methoxyphenyl)-6-thiophen-2-yl-2-pyridinyl]sulfanyl]-2-phenylacetic acid (PubChem CID 2962037) has the molecular formula C25H18N2O3S2 and a molecular weight of 458.56 g/mol. Its IUPAC name is 2-[[3-cyano-4-(4-methoxyphenyl)-6-thiophen-2-yl-2-pyridinyl]sulfanyl]-2-phenylacetic acid.
| Compound Name | 2-[[3-cyano-4-(4-methoxyphenyl)-6-thiophen-2-yl-2-pyridinyl]sulfanyl]-2-phenylacetic acid |
|---|---|
| PubChem CID | 2962037 |
| Molecular Formula | C25H18N2O3S2 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | 2-[[3-cyano-4-(4-methoxyphenyl)-6-thiophen-2-yl-2-pyridinyl]sulfanyl]-2-phenylacetic acid |
| SMILES | COc1ccc(-c2cc(-c3cccs3)nc(SC(C(=O)O)c3ccccc3)c2C#N)cc1 |
| InChI | InChI=1S/C25H18N2O3S2/c1-30-18-11-9-16(10-12-18)19-14-21(22-8-5-13-31-22)27-24(20(19)15-26)32-23(25(28)29)17-6-3-2-4-7-17/h2-14,23H,1H3,(H,28,29) |
| InChIKey | FMPHCYCAGGIJDZ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 83.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_pyr_A(3)', 'substructure': 'N/A'} |
|---|