C25H19N3O2S2 — CID 123877346
2-[[3-cyano-4-(4-methylphenyl)-6-thiophen-2-yl-2-pyridinyl]sulfanyl]-N-hydroxy-2-phenylacetamide (PubChem CID 123877346) has the molecular formula C25H19N3O2S2 and a molecular weight of 457.58 g/mol. Its IUPAC name is 2-[[3-cyano-4-(4-methylphenyl)-6-thiophen-2-yl-2-pyridinyl]sulfanyl]-N-hydroxy-2-phenylacetamide.
| Compound Name | 2-[[3-cyano-4-(4-methylphenyl)-6-thiophen-2-yl-2-pyridinyl]sulfanyl]-N-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 123877346 |
| Molecular Formula | C25H19N3O2S2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 2-[[3-cyano-4-(4-methylphenyl)-6-thiophen-2-yl-2-pyridinyl]sulfanyl]-N-hydroxy-2-phenylacetamide |
| SMILES | Cc1ccc(-c2cc(-c3cccs3)nc(SC(C(=O)NO)c3ccccc3)c2C#N)cc1 |
| InChI | InChI=1S/C25H19N3O2S2/c1-16-9-11-17(12-10-16)19-14-21(22-8-5-13-31-22)27-25(20(19)15-26)32-23(24(29)28-30)18-6-3-2-4-7-18/h2-14,23,30H,1H3,(H,28,29) |
| InChIKey | UTCRHWYMSUDPIP-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|