C21H17FN2O2S2 — CID 3960465
ethyl 2-[[3-cyano-4-(4-fluorophenyl)-6-thiophen-2-yl-2-pyridinyl]sulfanyl]propanoate (PubChem CID 3960465) has the molecular formula C21H17FN2O2S2 and a molecular weight of 412.51 g/mol. Its IUPAC name is ethyl 2-[[3-cyano-4-(4-fluorophenyl)-6-thiophen-2-yl-2-pyridinyl]sulfanyl]propanoate.
| Compound Name | ethyl 2-[[3-cyano-4-(4-fluorophenyl)-6-thiophen-2-yl-2-pyridinyl]sulfanyl]propanoate |
|---|---|
| PubChem CID | 3960465 |
| Molecular Formula | C21H17FN2O2S2 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | ethyl 2-[[3-cyano-4-(4-fluorophenyl)-6-thiophen-2-yl-2-pyridinyl]sulfanyl]propanoate |
| SMILES | CCOC(=O)C(C)Sc1nc(-c2cccs2)cc(-c2ccc(F)cc2)c1C#N |
| InChI | InChI=1S/C21H17FN2O2S2/c1-3-26-21(25)13(2)28-20-17(12-23)16(14-6-8-15(22)9-7-14)11-18(24-20)19-5-4-10-27-19/h4-11,13H,3H2,1-2H3 |
| InChIKey | QVKWNDMUORYXQX-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |