C18H10FN2O2S2- — CID 6984680
2-[[3-cyano-4-(4-fluorophenyl)-6-thiophen-2-yl-2-pyridinyl]sulfanyl]acetate (PubChem CID 6984680) has the molecular formula C18H10FN2O2S2- and a molecular weight of 369.42 g/mol. Its IUPAC name is 2-[[3-cyano-4-(4-fluorophenyl)-6-thiophen-2-yl-2-pyridinyl]sulfanyl]acetate.
| Compound Name | 2-[[3-cyano-4-(4-fluorophenyl)-6-thiophen-2-yl-2-pyridinyl]sulfanyl]acetate |
|---|---|
| PubChem CID | 6984680 |
| Molecular Formula | C18H10FN2O2S2- |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | 2-[[3-cyano-4-(4-fluorophenyl)-6-thiophen-2-yl-2-pyridinyl]sulfanyl]acetate |
| SMILES | N#Cc1c(-c2ccc(F)cc2)cc(-c2cccs2)nc1SCC(=O)[O-] |
| InChI | InChI=1S/C18H11FN2O2S2/c19-12-5-3-11(4-6-12)13-8-15(16-2-1-7-24-16)21-18(14(13)9-20)25-10-17(22)23/h1-8H,10H2,(H,22,23)/p-1 |
| InChIKey | LQCVNFADRMEHDE-UHFFFAOYSA-M |
| XLogP | 3.33 |
| TPSA | 76.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |