C23H16N2S2 — CID 3334393
2-benzylsulfanyl-4-phenyl-6-thiophen-2-ylpyridine-3-carbonitrile (PubChem CID 3334393) has the molecular formula C23H16N2S2 and a molecular weight of 384.53 g/mol. Its IUPAC name is 2-benzylsulfanyl-4-phenyl-6-thiophen-2-ylpyridine-3-carbonitrile.
| Compound Name | 2-benzylsulfanyl-4-phenyl-6-thiophen-2-ylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3334393 |
| Molecular Formula | C23H16N2S2 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 2-benzylsulfanyl-4-phenyl-6-thiophen-2-ylpyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)cc(-c2cccs2)nc1SCc1ccccc1 |
| InChI | InChI=1S/C23H16N2S2/c24-15-20-19(18-10-5-2-6-11-18)14-21(22-12-7-13-26-22)25-23(20)27-16-17-8-3-1-4-9-17/h1-14H,16H2 |
| InChIKey | QVRKXBUZZQCWPS-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |