C19H14N2O2S2 — CID 5120722
2-[(3-cyano-4-phenyl-6-thiophen-2-yl-2-pyridinyl)sulfanyl]propanoic acid (PubChem CID 5120722) has the molecular formula C19H14N2O2S2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 2-[(3-cyano-4-phenyl-6-thiophen-2-yl-2-pyridinyl)sulfanyl]propanoic acid.
| Compound Name | 2-[(3-cyano-4-phenyl-6-thiophen-2-yl-2-pyridinyl)sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 5120722 |
| Molecular Formula | C19H14N2O2S2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 2-[(3-cyano-4-phenyl-6-thiophen-2-yl-2-pyridinyl)sulfanyl]propanoic acid |
| SMILES | CC(Sc1nc(-c2cccs2)cc(-c2ccccc2)c1C#N)C(=O)O |
| InChI | InChI=1S/C19H14N2O2S2/c1-12(19(22)23)25-18-15(11-20)14(13-6-3-2-4-7-13)10-16(21-18)17-8-5-9-24-17/h2-10,12H,1H3,(H,22,23) |
| InChIKey | LJONEXQVXKPANV-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |