C33H25N3OS — CID 23744241
2-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N,N-diphenylpropanamide (PubChem CID 23744241) has the molecular formula C33H25N3OS and a molecular weight of 511.65 g/mol. Its IUPAC name is 2-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N,N-diphenylpropanamide.
| Compound Name | 2-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N,N-diphenylpropanamide |
|---|---|
| PubChem CID | 23744241 |
| Molecular Formula | C33H25N3OS |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | 2-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]-N,N-diphenylpropanamide |
| SMILES | CC(Sc1nc(-c2ccccc2)cc(-c2ccccc2)c1C#N)C(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H25N3OS/c1-24(33(37)36(27-18-10-4-11-19-27)28-20-12-5-13-21-28)38-32-30(23-34)29(25-14-6-2-7-15-25)22-31(35-32)26-16-8-3-9-17-26/h2-22,24H,1H3 |
| InChIKey | PAOOWBJXWYSMON-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |