C28H22N4O3S — CID 3126912
2-[[3-cyano-4-(4-methylphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-(3-nitrophenyl)propanamide (PubChem CID 3126912) has the molecular formula C28H22N4O3S and a molecular weight of 494.58 g/mol. Its IUPAC name is 2-[[3-cyano-4-(4-methylphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-(3-nitrophenyl)propanamide.
| Compound Name | 2-[[3-cyano-4-(4-methylphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-(3-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 3126912 |
| Molecular Formula | C28H22N4O3S |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 2-[[3-cyano-4-(4-methylphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-(3-nitrophenyl)propanamide |
| SMILES | Cc1ccc(-c2cc(-c3ccccc3)nc(SC(C)C(=O)Nc3cccc([N+](=O)[O-])c3)c2C#N)cc1 |
| InChI | InChI=1S/C28H22N4O3S/c1-18-11-13-20(14-12-18)24-16-26(21-7-4-3-5-8-21)31-28(25(24)17-29)36-19(2)27(33)30-22-9-6-10-23(15-22)32(34)35/h3-16,19H,1-2H3,(H,30,33) |
| InChIKey | QJQJMYXJWYEHIF-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|