C31H28N4O5S — CID 3125928
2-[[3-cyano-4-(3,4-dimethoxyphenyl)-6-(4-methylphenyl)-2-pyridinyl]sulfanyl]-N-(4-methyl-3-nitrophenyl)propanamide (PubChem CID 3125928) has the molecular formula C31H28N4O5S and a molecular weight of 568.66 g/mol. Its IUPAC name is 2-[[3-cyano-4-(3,4-dimethoxyphenyl)-6-(4-methylphenyl)-2-pyridinyl]sulfanyl]-N-(4-methyl-3-nitrophenyl)propanamide.
| Compound Name | 2-[[3-cyano-4-(3,4-dimethoxyphenyl)-6-(4-methylphenyl)-2-pyridinyl]sulfanyl]-N-(4-methyl-3-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 3125928 |
| Molecular Formula | C31H28N4O5S |
| Molecular Weight | 568.66 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | 2-[[3-cyano-4-(3,4-dimethoxyphenyl)-6-(4-methylphenyl)-2-pyridinyl]sulfanyl]-N-(4-methyl-3-nitrophenyl)propanamide |
| SMILES | COc1ccc(-c2cc(-c3ccc(C)cc3)nc(SC(C)C(=O)Nc3ccc(C)c([N+](=O)[O-])c3)c2C#N)cc1OC |
| InChI | InChI=1S/C31H28N4O5S/c1-18-6-9-21(10-7-18)26-16-24(22-11-13-28(39-4)29(14-22)40-5)25(17-32)31(34-26)41-20(3)30(36)33-23-12-8-19(2)27(15-23)35(37)38/h6-16,20H,1-5H3,(H,33,36) |
| InChIKey | GXRFDHXJLSHDBO-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 127.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.66 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_thio_pyr_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|