C31H29N3O3S — CID 3165455
2-[[3-cyano-4-(3,4-dimethoxyphenyl)-6-(4-methylphenyl)-2-pyridinyl]sulfanyl]-N-(2-methylphenyl)propanamide (PubChem CID 3165455) has the molecular formula C31H29N3O3S and a molecular weight of 523.66 g/mol. Its IUPAC name is 2-[[3-cyano-4-(3,4-dimethoxyphenyl)-6-(4-methylphenyl)-2-pyridinyl]sulfanyl]-N-(2-methylphenyl)propanamide.
| Compound Name | 2-[[3-cyano-4-(3,4-dimethoxyphenyl)-6-(4-methylphenyl)-2-pyridinyl]sulfanyl]-N-(2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 3165455 |
| Molecular Formula | C31H29N3O3S |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | 2-[[3-cyano-4-(3,4-dimethoxyphenyl)-6-(4-methylphenyl)-2-pyridinyl]sulfanyl]-N-(2-methylphenyl)propanamide |
| SMILES | COc1ccc(-c2cc(-c3ccc(C)cc3)nc(SC(C)C(=O)Nc3ccccc3C)c2C#N)cc1OC |
| InChI | InChI=1S/C31H29N3O3S/c1-19-10-12-22(13-11-19)27-17-24(23-14-15-28(36-4)29(16-23)37-5)25(18-32)31(34-27)38-21(3)30(35)33-26-9-7-6-8-20(26)2/h6-17,21H,1-5H3,(H,33,35) |
| InChIKey | MADHCEZVGIGNDU-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_pyr_A(3)', 'substructure': 'N/A'} |
|---|