C30H26ClN3O3S — CID 3165479
2-[[6-(4-chlorophenyl)-3-cyano-4-(3,4-dimethoxyphenyl)-2-pyridinyl]sulfanyl]-N-(2,3-dimethylphenyl)acetamide (PubChem CID 3165479) has the molecular formula C30H26ClN3O3S and a molecular weight of 544.08 g/mol. Its IUPAC name is 2-[[6-(4-chlorophenyl)-3-cyano-4-(3,4-dimethoxyphenyl)-2-pyridinyl]sulfanyl]-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-[[6-(4-chlorophenyl)-3-cyano-4-(3,4-dimethoxyphenyl)-2-pyridinyl]sulfanyl]-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 3165479 |
| Molecular Formula | C30H26ClN3O3S |
| Molecular Weight | 544.08 g/mol |
| Exact Mass | 543.14 |
| IUPAC Name | 2-[[6-(4-chlorophenyl)-3-cyano-4-(3,4-dimethoxyphenyl)-2-pyridinyl]sulfanyl]-N-(2,3-dimethylphenyl)acetamide |
| SMILES | COc1ccc(-c2cc(-c3ccc(Cl)cc3)nc(SCC(=O)Nc3cccc(C)c3C)c2C#N)cc1OC |
| InChI | InChI=1S/C30H26ClN3O3S/c1-18-6-5-7-25(19(18)2)33-29(35)17-38-30-24(16-32)23(21-10-13-27(36-3)28(14-21)37-4)15-26(34-30)20-8-11-22(31)12-9-20/h5-15H,17H2,1-4H3,(H,33,35) |
| InChIKey | POUYWVIOYVLTIU-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.08 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_pyr_A(3)', 'substructure': 'N/A'} |
|---|