C29H22Cl3N3O3S — CID 3128548
2-[[3-cyano-4-(3,4-dimethoxyphenyl)-6-(4-methylphenyl)-2-pyridinyl]sulfanyl]-N-(2,4,6-trichlorophenyl)acetamide (PubChem CID 3128548) has the molecular formula C29H22Cl3N3O3S and a molecular weight of 598.94 g/mol. Its IUPAC name is 2-[[3-cyano-4-(3,4-dimethoxyphenyl)-6-(4-methylphenyl)-2-pyridinyl]sulfanyl]-N-(2,4,6-trichlorophenyl)acetamide.
| Compound Name | 2-[[3-cyano-4-(3,4-dimethoxyphenyl)-6-(4-methylphenyl)-2-pyridinyl]sulfanyl]-N-(2,4,6-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 3128548 |
| Molecular Formula | C29H22Cl3N3O3S |
| Molecular Weight | 598.94 g/mol |
| Exact Mass | 597.04 |
| IUPAC Name | 2-[[3-cyano-4-(3,4-dimethoxyphenyl)-6-(4-methylphenyl)-2-pyridinyl]sulfanyl]-N-(2,4,6-trichlorophenyl)acetamide |
| SMILES | COc1ccc(-c2cc(-c3ccc(C)cc3)nc(SCC(=O)Nc3c(Cl)cc(Cl)cc3Cl)c2C#N)cc1OC |
| InChI | InChI=1S/C29H22Cl3N3O3S/c1-16-4-6-17(7-5-16)24-13-20(18-8-9-25(37-2)26(10-18)38-3)21(14-33)29(34-24)39-15-27(36)35-28-22(31)11-19(30)12-23(28)32/h4-13H,15H2,1-3H3,(H,35,36) |
| InChIKey | DBVPADKRQSLOJK-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.94 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_pyr_A(3)', 'substructure': 'N/A'} |
|---|