C27H20ClN3O3S — CID 155811577
2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-4-(3,4-dimethoxyphenyl)-6-pyridin-3-ylpyridine-3-carbonitrile (PubChem CID 155811577) has the molecular formula C27H20ClN3O3S and a molecular weight of 502.00 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-4-(3,4-dimethoxyphenyl)-6-pyridin-3-ylpyridine-3-carbonitrile.
| Compound Name | 2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-4-(3,4-dimethoxyphenyl)-6-pyridin-3-ylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 155811577 |
| Molecular Formula | C27H20ClN3O3S |
| Molecular Weight | 502.00 g/mol |
| Exact Mass | 501.09 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-4-(3,4-dimethoxyphenyl)-6-pyridin-3-ylpyridine-3-carbonitrile |
| SMILES | COc1ccc(-c2cc(-c3cccnc3)nc(SCC(=O)c3ccc(Cl)cc3)c2C#N)cc1OC |
| InChI | InChI=1S/C27H20ClN3O3S/c1-33-25-10-7-18(12-26(25)34-2)21-13-23(19-4-3-11-30-15-19)31-27(22(21)14-29)35-16-24(32)17-5-8-20(28)9-6-17/h3-13,15H,16H2,1-2H3 |
| InChIKey | TXDXNCFRWRZREG-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 85.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.00 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_pyr_A(3)', 'substructure': 'N/A'} |
|---|