C35H27ClN4O5S — CID 3130384
N-[(4-chlorophenyl)methyl]-2-[[3-cyano-4-(3,4-dimethoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-(4-nitrophenyl)acetamide (PubChem CID 3130384) has the molecular formula C35H27ClN4O5S and a molecular weight of 651.14 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[[3-cyano-4-(3,4-dimethoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-(4-nitrophenyl)acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[[3-cyano-4-(3,4-dimethoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3130384 |
| Molecular Formula | C35H27ClN4O5S |
| Molecular Weight | 651.14 g/mol |
| Exact Mass | 650.14 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[[3-cyano-4-(3,4-dimethoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-(4-nitrophenyl)acetamide |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)nc(SCC(=O)N(Cc3ccc(Cl)cc3)c3ccc([N+](=O)[O-])cc3)c2C#N)cc1OC |
| InChI | InChI=1S/C35H27ClN4O5S/c1-44-32-17-10-25(18-33(32)45-2)29-19-31(24-6-4-3-5-7-24)38-35(30(29)20-37)46-22-34(41)39(21-23-8-11-26(36)12-9-23)27-13-15-28(16-14-27)40(42)43/h3-19H,21-22H2,1-2H3 |
| InChIKey | LWGDARVZFRBTPB-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 118.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.14 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_thio_pyr_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|