C28H21ClN4O4S — CID 3131982
2-[[4-(4-chlorophenyl)-3-cyano-6-(4-methoxyphenyl)-2-pyridinyl]sulfanyl]-N-(2-methyl-5-nitrophenyl)acetamide (PubChem CID 3131982) has the molecular formula C28H21ClN4O4S and a molecular weight of 545.02 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)-3-cyano-6-(4-methoxyphenyl)-2-pyridinyl]sulfanyl]-N-(2-methyl-5-nitrophenyl)acetamide.
| Compound Name | 2-[[4-(4-chlorophenyl)-3-cyano-6-(4-methoxyphenyl)-2-pyridinyl]sulfanyl]-N-(2-methyl-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3131982 |
| Molecular Formula | C28H21ClN4O4S |
| Molecular Weight | 545.02 g/mol |
| Exact Mass | 544.10 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)-3-cyano-6-(4-methoxyphenyl)-2-pyridinyl]sulfanyl]-N-(2-methyl-5-nitrophenyl)acetamide |
| SMILES | COc1ccc(-c2cc(-c3ccc(Cl)cc3)c(C#N)c(SCC(=O)Nc3cc([N+](=O)[O-])ccc3C)n2)cc1 |
| InChI | InChI=1S/C28H21ClN4O4S/c1-17-3-10-21(33(35)36)13-25(17)31-27(34)16-38-28-24(15-30)23(18-4-8-20(29)9-5-18)14-26(32-28)19-6-11-22(37-2)12-7-19/h3-14H,16H2,1-2H3,(H,31,34) |
| InChIKey | CHPNOGCDIYUSEA-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 118.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.02 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|