C29H24N4O5S — CID 3128562
2-[[3-cyano-4-(4-methoxyphenyl)-6-(4-methylphenyl)-2-pyridinyl]sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide (PubChem CID 3128562) has the molecular formula C29H24N4O5S and a molecular weight of 540.60 g/mol. Its IUPAC name is 2-[[3-cyano-4-(4-methoxyphenyl)-6-(4-methylphenyl)-2-pyridinyl]sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide.
| Compound Name | 2-[[3-cyano-4-(4-methoxyphenyl)-6-(4-methylphenyl)-2-pyridinyl]sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3128562 |
| Molecular Formula | C29H24N4O5S |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.15 |
| IUPAC Name | 2-[[3-cyano-4-(4-methoxyphenyl)-6-(4-methylphenyl)-2-pyridinyl]sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide |
| SMILES | COc1ccc(-c2cc(-c3ccc(C)cc3)nc(SCC(=O)Nc3ccc(OC)cc3[N+](=O)[O-])c2C#N)cc1 |
| InChI | InChI=1S/C29H24N4O5S/c1-18-4-6-20(7-5-18)26-15-23(19-8-10-21(37-2)11-9-19)24(16-30)29(32-26)39-17-28(34)31-25-13-12-22(38-3)14-27(25)33(35)36/h4-15H,17H2,1-3H3,(H,31,34) |
| InChIKey | XCVSMPZHFBZQRI-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 127.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_thio_pyr_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|