C20H13F3N4O5S — CID 19583368
2-[[3-cyano-4-(furan-2-yl)-6-(trifluoromethyl)-2-pyridinyl]sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide (PubChem CID 19583368) has the molecular formula C20H13F3N4O5S and a molecular weight of 478.41 g/mol. Its IUPAC name is 2-[[3-cyano-4-(furan-2-yl)-6-(trifluoromethyl)-2-pyridinyl]sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide.
| Compound Name | 2-[[3-cyano-4-(furan-2-yl)-6-(trifluoromethyl)-2-pyridinyl]sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 19583368 |
| Molecular Formula | C20H13F3N4O5S |
| Molecular Weight | 478.41 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | 2-[[3-cyano-4-(furan-2-yl)-6-(trifluoromethyl)-2-pyridinyl]sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CSc2nc(C(F)(F)F)cc(-c3ccco3)c2C#N)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H13F3N4O5S/c1-31-11-4-5-14(15(7-11)27(29)30)25-18(28)10-33-19-13(9-24)12(16-3-2-6-32-16)8-17(26-19)20(21,22)23/h2-8H,10H2,1H3,(H,25,28) |
| InChIKey | OJBRZSLWXYZYAE-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 131.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.41 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|