C27H18ClN5O4S — CID 3132366
N'-[2-[[4-(4-chlorophenyl)-3-cyano-6-phenyl-2-pyridinyl]sulfanyl]acetyl]-3-nitrobenzohydrazide (PubChem CID 3132366) has the molecular formula C27H18ClN5O4S and a molecular weight of 543.99 g/mol. Its IUPAC name is N'-[2-[[4-(4-chlorophenyl)-3-cyano-6-phenyl-2-pyridinyl]sulfanyl]acetyl]-3-nitrobenzohydrazide.
| Compound Name | N'-[2-[[4-(4-chlorophenyl)-3-cyano-6-phenyl-2-pyridinyl]sulfanyl]acetyl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 3132366 |
| Molecular Formula | C27H18ClN5O4S |
| Molecular Weight | 543.99 g/mol |
| Exact Mass | 543.08 |
| IUPAC Name | N'-[2-[[4-(4-chlorophenyl)-3-cyano-6-phenyl-2-pyridinyl]sulfanyl]acetyl]-3-nitrobenzohydrazide |
| SMILES | N#Cc1c(-c2ccc(Cl)cc2)cc(-c2ccccc2)nc1SCC(=O)NNC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H18ClN5O4S/c28-20-11-9-17(10-12-20)22-14-24(18-5-2-1-3-6-18)30-27(23(22)15-29)38-16-25(34)31-32-26(35)19-7-4-8-21(13-19)33(36)37/h1-14H,16H2,(H,31,34)(H,32,35) |
| InChIKey | UFKLNZFOAHOBCL-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 138.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.99 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|