C35H28N4O5S — CID 3131127
2-[[3-cyano-4-(3-ethoxy-4-phenylmethoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-(3-nitrophenyl)acetamide (PubChem CID 3131127) has the molecular formula C35H28N4O5S and a molecular weight of 616.70 g/mol. Its IUPAC name is 2-[[3-cyano-4-(3-ethoxy-4-phenylmethoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[[3-cyano-4-(3-ethoxy-4-phenylmethoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3131127 |
| Molecular Formula | C35H28N4O5S |
| Molecular Weight | 616.70 g/mol |
| Exact Mass | 616.18 |
| IUPAC Name | 2-[[3-cyano-4-(3-ethoxy-4-phenylmethoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-(3-nitrophenyl)acetamide |
| SMILES | CCOc1cc(-c2cc(-c3ccccc3)nc(SCC(=O)Nc3cccc([N+](=O)[O-])c3)c2C#N)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C35H28N4O5S/c1-2-43-33-18-26(16-17-32(33)44-22-24-10-5-3-6-11-24)29-20-31(25-12-7-4-8-13-25)38-35(30(29)21-36)45-23-34(40)37-27-14-9-15-28(19-27)39(41)42/h3-20H,2,22-23H2,1H3,(H,37,40) |
| InChIKey | FLVFNNNVWISRSS-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 127.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.70 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_thio_pyr_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|