C24H22N4O3S — CID 4264154
2-[(6-tert-butyl-3-cyano-4-phenyl-2-pyridinyl)sulfanyl]-N-(3-nitrophenyl)acetamide (PubChem CID 4264154) has the molecular formula C24H22N4O3S and a molecular weight of 446.53 g/mol. Its IUPAC name is 2-[(6-tert-butyl-3-cyano-4-phenyl-2-pyridinyl)sulfanyl]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[(6-tert-butyl-3-cyano-4-phenyl-2-pyridinyl)sulfanyl]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 4264154 |
| Molecular Formula | C24H22N4O3S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 2-[(6-tert-butyl-3-cyano-4-phenyl-2-pyridinyl)sulfanyl]-N-(3-nitrophenyl)acetamide |
| SMILES | CC(C)(C)c1cc(-c2ccccc2)c(C#N)c(SCC(=O)Nc2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C24H22N4O3S/c1-24(2,3)21-13-19(16-8-5-4-6-9-16)20(14-25)23(27-21)32-15-22(29)26-17-10-7-11-18(12-17)28(30)31/h4-13H,15H2,1-3H3,(H,26,29) |
| InChIKey | RAIRZMOPSFWTGI-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|