C22H16N4O3S — CID 3134201
N-(3-nitrophenyl)-2-(2-phenylquinazolin-4-yl)sulfanylacetamide (PubChem CID 3134201) has the molecular formula C22H16N4O3S and a molecular weight of 416.46 g/mol. Its IUPAC name is N-(3-nitrophenyl)-2-(2-phenylquinazolin-4-yl)sulfanylacetamide.
| Compound Name | N-(3-nitrophenyl)-2-(2-phenylquinazolin-4-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 3134201 |
| Molecular Formula | C22H16N4O3S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | N-(3-nitrophenyl)-2-(2-phenylquinazolin-4-yl)sulfanylacetamide |
| SMILES | O=C(CSc1nc(-c2ccccc2)nc2ccccc12)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H16N4O3S/c27-20(23-16-9-6-10-17(13-16)26(28)29)14-30-22-18-11-4-5-12-19(18)24-21(25-22)15-7-2-1-3-8-15/h1-13H,14H2,(H,23,27) |
| InChIKey | AETPTCPPSMYDGV-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|