C26H24N4O3S2 — CID 1155564
2-(2-phenylquinazolin-4-yl)sulfanyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)acetamide (PubChem CID 1155564) has the molecular formula C26H24N4O3S2 and a molecular weight of 504.64 g/mol. Its IUPAC name is 2-(2-phenylquinazolin-4-yl)sulfanyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-(2-phenylquinazolin-4-yl)sulfanyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 1155564 |
| Molecular Formula | C26H24N4O3S2 |
| Molecular Weight | 504.64 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | 2-(2-phenylquinazolin-4-yl)sulfanyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)acetamide |
| SMILES | O=C(CSc1nc(-c2ccccc2)nc2ccccc12)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C26H24N4O3S2/c31-24(27-20-12-14-21(15-13-20)35(32,33)30-16-6-7-17-30)18-34-26-22-10-4-5-11-23(22)28-25(29-26)19-8-2-1-3-9-19/h1-5,8-15H,6-7,16-18H2,(H,27,31) |
| InChIKey | JEHJLWATSHKERF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.64 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |