C23H18FN3OS — CID 1129852
2-(6-fluoro-2-phenylquinazolin-4-yl)sulfanyl-N-(3-methylphenyl)acetamide (PubChem CID 1129852) has the molecular formula C23H18FN3OS and a molecular weight of 403.48 g/mol. Its IUPAC name is 2-(6-fluoro-2-phenylquinazolin-4-yl)sulfanyl-N-(3-methylphenyl)acetamide.
| Compound Name | 2-(6-fluoro-2-phenylquinazolin-4-yl)sulfanyl-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 1129852 |
| Molecular Formula | C23H18FN3OS |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 2-(6-fluoro-2-phenylquinazolin-4-yl)sulfanyl-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CSc2nc(-c3ccccc3)nc3ccc(F)cc23)c1 |
| InChI | InChI=1S/C23H18FN3OS/c1-15-6-5-9-18(12-15)25-21(28)14-29-23-19-13-17(24)10-11-20(19)26-22(27-23)16-7-3-2-4-8-16/h2-13H,14H2,1H3,(H,25,28) |
| InChIKey | NJFIOIBPRCAQDN-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |