C23H17ClFN3OS — CID 3136401
N-(3-chloro-4-methylphenyl)-2-(6-fluoro-2-phenylquinazolin-4-yl)sulfanylacetamide (PubChem CID 3136401) has the molecular formula C23H17ClFN3OS and a molecular weight of 437.93 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-(6-fluoro-2-phenylquinazolin-4-yl)sulfanylacetamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-(6-fluoro-2-phenylquinazolin-4-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 3136401 |
| Molecular Formula | C23H17ClFN3OS |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-(6-fluoro-2-phenylquinazolin-4-yl)sulfanylacetamide |
| SMILES | Cc1ccc(NC(=O)CSc2nc(-c3ccccc3)nc3ccc(F)cc23)cc1Cl |
| InChI | InChI=1S/C23H17ClFN3OS/c1-14-7-9-17(12-19(14)24)26-21(29)13-30-23-18-11-16(25)8-10-20(18)27-22(28-23)15-5-3-2-4-6-15/h2-12H,13H2,1H3,(H,26,29) |
| InChIKey | FHNGPPRBWIZEBI-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |